Acetamide,N,N'-(2,5-dichloro-3,6-dioxo-1,4-cyclohexadiene-1,4-diyl)bis- structure
|
Common Name | Acetamide,N,N'-(2,5-dichloro-3,6-dioxo-1,4-cyclohexadiene-1,4-diyl)bis- | ||
|---|---|---|---|---|
| CAS Number | 7510-09-0 | Molecular Weight | 291.08800 | |
| Density | 1.54g/cm3 | Boiling Point | 518.2ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.2ºC | |
| Name | N-(4-acetamido-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 518.2ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2N2O4 |
| Molecular Weight | 291.08800 |
| Flash Point | 267.2ºC |
| Exact Mass | 289.98600 |
| PSA | 92.34000 |
| LogP | 1.09300 |
| Index of Refraction | 1.58 |
| InChIKey | ZYWQUADTNKEZKA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(Cl)C(=O)C(NC(C)=O)=C(Cl)C1=O |
|
~%
Acetamide,N,N'-... CAS#:7510-09-0 |
| Literature: Fieser; Martin Journal of the American Chemical Society, 1935 , vol. 57, p. 1844,1848 |
|
~%
Acetamide,N,N'-... CAS#:7510-09-0 |
| Literature: Fieser; Martin Journal of the American Chemical Society, 1935 , vol. 57, p. 1844,1848 |
| 2,5-Dichlor-3,5-acetylamino-1,4-benzochinon |
| 2,5-Bis-<acetylamino>-3,6-dichlor-1,4-benzochinon |
| 2,5-diacetylamino-3,6-dichloro-1,4-benzoquinone |