2-(4-bromophenyl)ethyl N-phenylcarbamate structure
|
Common Name | 2-(4-bromophenyl)ethyl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 7510-67-0 | Molecular Weight | 320.18100 | |
| Density | 1.44g/cm3 | Boiling Point | 395.7ºC at 760 mmHg | |
| Molecular Formula | C15H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 2-(4-bromophenyl)ethyl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 395.7ºC at 760 mmHg |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.18100 |
| Flash Point | 193.1ºC |
| Exact Mass | 319.02100 |
| PSA | 38.33000 |
| LogP | 4.31330 |
| Index of Refraction | 1.629 |
| InChIKey | YUTIIQHGAHXSST-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)OCCc1ccc(Br)cc1 |
|
~%
2-(4-bromopheny... CAS#:7510-67-0 |
| Literature: Taylor; Hobson Journal of the Chemical Society, 1936 , p. 181,183 |
|
~%
2-(4-bromopheny... CAS#:7510-67-0 |
| Literature: Taylor; Hobson Journal of the Chemical Society, 1936 , p. 181,183 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phenyl-carbamidsaeure-(4-brom-phenaethylester) |
| phenyl-carbamic acid-(4-bromo-phenethyl ester) |