propan-2-yl (Z)-2-methyl-3-phenyl-prop-2-enoate structure
|
Common Name | propan-2-yl (Z)-2-methyl-3-phenyl-prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 7510-76-1 | Molecular Weight | 204.26500 | |
| Density | 1.02g/cm3 | Boiling Point | 290.8ºC at 760 mmHg | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.8ºC | |
| Name | propan-2-yl (Z)-2-methyl-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 290.8ºC at 760 mmHg |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.26500 |
| Flash Point | 150.8ºC |
| Exact Mass | 204.11500 |
| PSA | 26.30000 |
| LogP | 3.04150 |
| Index of Refraction | 1.534 |
| InChIKey | VJLFJKQJEJZORR-LUAWRHEFSA-N |
| SMILES | CC(=Cc1ccccc1)C(=O)OC(C)C |
|
~84%
propan-2-yl (Z)... CAS#:7510-76-1 |
| Literature: Li, Jia-Qi; Quan, Xu; Andersson, Pher G. Chemistry - A European Journal, 2012 , vol. 18, # 34 p. 10609 - 10616 |
|
~%
propan-2-yl (Z)... CAS#:7510-76-1 |
| Literature: Cohen; Whiteley Journal of the Chemical Society, 1901 , vol. 79, p. 1308 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-methyl-3-phenyl-acrylic acid isopropyl ester |
| 2-Methyl-3-phenyl-acrylsaeure-isopropylester |