Acetamide,N-[(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]- structure
|
Common Name | Acetamide,N-[(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 7511-06-0 | Molecular Weight | 202.20900 | |
| Density | 1.341g/cm3 | Boiling Point | 514.2ºC at 760mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1ºC | |
| Name | N-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]acetamide |
|---|
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 514.2ºC at 760mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 235.1ºC |
| Exact Mass | 202.07400 |
| PSA | 58.20000 |
| LogP | 1.64460 |
| Index of Refraction | 1.672 |
| InChIKey | NVKWGPYFPGCRBK-UHFFFAOYSA-N |
| SMILES | CC(=O)N=Cc1c(O)[nH]c2ccccc12 |
|
~%
Acetamide,N-[(1... CAS#:7511-06-0 |
| Literature: Wenkert et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3763,3766 |
|
~%
Acetamide,N-[(1... CAS#:7511-06-0 |
| Literature: Wenkert et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3763,3766 |