6-[methyl(phenylsulphonyl)amino]hexanoic acid, compound with 2-aminoethanol (1:1) structure
|
Common Name | 6-[methyl(phenylsulphonyl)amino]hexanoic acid, compound with 2-aminoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 75113-57-4 | Molecular Weight | 346.44200 | |
| Density | N/A | Boiling Point | 464.4ºC at 760 mmHg | |
| Molecular Formula | C15H26N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.7ºC | |
| Name | 2-aminoethanol,6-[benzenesulfonyl(methyl)amino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 464.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.44200 |
| Flash Point | 234.7ºC |
| Exact Mass | 346.15600 |
| PSA | 129.31000 |
| LogP | 2.67060 |
| InChIKey | DUFAUUOAXDKLGV-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)S(=O)(=O)c1ccccc1.NCCO |
| einecs 278-071-4 |