bis(2,2-diphenylethyl) oxalate structure
|
Common Name | bis(2,2-diphenylethyl) oxalate | ||
|---|---|---|---|---|
| CAS Number | 7512-05-2 | Molecular Weight | 450.52500 | |
| Density | 1.174g/cm3 | Boiling Point | 583.1ºC at 760 mmHg | |
| Molecular Formula | C30H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.4ºC | |
| Name | bis(2,2-diphenylethyl) oxalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 583.1ºC at 760 mmHg |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.52500 |
| Flash Point | 248.4ºC |
| Exact Mass | 450.18300 |
| PSA | 52.60000 |
| LogP | 5.73700 |
| Index of Refraction | 1.599 |
| InChIKey | RDCUMLHEZGJHOE-UHFFFAOYSA-N |
| SMILES | O=C(OCC(c1ccccc1)c1ccccc1)C(=O)OCC(c1ccccc1)c1ccccc1 |
|
~%
bis(2,2-dipheny... CAS#:7512-05-2 |
| Literature: Kharasch; Clapp Journal of Organic Chemistry, 1938 , vol. 3, p. 355,359 |
|
~%
bis(2,2-dipheny... CAS#:7512-05-2 |
| Literature: Kharasch; Clapp Journal of Organic Chemistry, 1938 , vol. 3, p. 355,359 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis-(2.2-diphenyl-aethyl)-oxalat |
| Oxalsaeure-bis-(2,2-diphenyl-aethylester) |
| oxalic acid bis-(2,2-diphenyl-ethyl ester) |