ethyl 7-oxo-4-phenyl-azepane-4-carboxylate structure
|
Common Name | ethyl 7-oxo-4-phenyl-azepane-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7512-08-5 | Molecular Weight | 261.31600 | |
| Density | 1.119g/cm3 | Boiling Point | 438.1ºC at 760 mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.8ºC | |
| Name | ethyl 7-oxo-4-phenylazepane-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 438.1ºC at 760 mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 218.8ºC |
| Exact Mass | 261.13600 |
| PSA | 55.40000 |
| LogP | 2.11640 |
| Index of Refraction | 1.52 |
| InChIKey | BSAYNGMOVKKEIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CCNC(=O)CC1 |
|
~%
ethyl 7-oxo-4-p... CAS#:7512-08-5 |
| Literature: Blicke; Tsao Journal of the American Chemical Society, 1953 , vol. 75, p. 3999,4001 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-Oxo-4-phenyl-hexahydro-azepin-4-carbonsaeure-aethylester |
| Ethyl 7-oxo-4-phenyl-4-azepanecarboxylate |
| ETHYL 7-OXO-4-PHENYL-AZEPANE-4-CARBOXYLATE |
| 7-oxo-4-phenyl-hexahydro-azepine-4-carboxylic acid ethyl ester |