1H-Azepinium,hexahydro-4-(hydroxymethyl)-1,1-dimethyl-4-phenyl-, bromide (1:1) structure
|
Common Name | 1H-Azepinium,hexahydro-4-(hydroxymethyl)-1,1-dimethyl-4-phenyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7512-11-0 | Molecular Weight | 314.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1,1-dimethyl-4-phenylazepan-1-ium-4-yl)methanol,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24BrNO |
|---|---|
| Molecular Weight | 314.26100 |
| Exact Mass | 313.10400 |
| PSA | 20.23000 |
| InChIKey | NLYPYXZOHLKWNJ-UHFFFAOYSA-M |
| SMILES | C[N+]1(C)CCCC(CO)(c2ccccc2)CC1.[Br-] |
|
~%
1H-Azepinium,he... CAS#:7512-11-0 |
| Literature: Blicke; Tsao Journal of the American Chemical Society, 1953 , vol. 75, p. 3999,4001 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-hydroxymethyl-1,1-dimethyl-4-phenyl-hexahydro-azepinium,bromide |