1-Propanone,3,3',3''-nitrilotris[1-phenyl- structure
|
Common Name | 1-Propanone,3,3',3''-nitrilotris[1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 7512-36-9 | Molecular Weight | 413.50800 | |
| Density | 1.14g/cm3 | Boiling Point | 590.2ºC at 760mmHg | |
| Molecular Formula | C27H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4ºC | |
| Name | 3-[bis(3-oxo-3-phenylpropyl)amino]-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 590.2ºC at 760mmHg |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.50800 |
| Flash Point | 249.4ºC |
| Exact Mass | 413.19900 |
| PSA | 54.45000 |
| LogP | 5.10740 |
| Index of Refraction | 1.589 |
| InChIKey | AZDCRHWRAARDET-UHFFFAOYSA-N |
| SMILES | O=C(CCN(CCC(=O)c1ccccc1)CCC(=O)c1ccccc1)c1ccccc1 |
|
~58%
1-Propanone,3,3... CAS#:7512-36-9 |
| Literature: Gadhwal; Baruah; Prajapati; Sandhu Synlett, 2000 , # 3 p. 341 - 342 |
|
~%
1-Propanone,3,3... CAS#:7512-36-9 |
| Literature: Uchino Bulletin of the Chemical Society of Japan, 1959 , vol. 32, p. 1012 |
|
~%
1-Propanone,3,3... CAS#:7512-36-9 |
| Literature: Mannich; Abdullah Chemische Berichte, 1935 , vol. 68, p. 113,120 |
|
~%
1-Propanone,3,3... CAS#:7512-36-9 |
| Literature: Mannich; Abdullah Chemische Berichte, 1935 , vol. 68, p. 113,120 |
| tris-(3-oxo-3-phenyl-propyl)-amine |
| Tris-(3-oxo-3-phenyl-propyl)-amin |