4-amino-N-(3,5-dibromo-4-methylamino-phenyl)benzenesulfonamide structure
|
Common Name | 4-amino-N-(3,5-dibromo-4-methylamino-phenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7512-70-1 | Molecular Weight | 435.13400 | |
| Density | 1.87g/cm3 | Boiling Point | 549.7ºC at 760 mmHg | |
| Molecular Formula | C13H13Br2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.3ºC | |
| Name | 4-amino-N-[3,5-dibromo-4-(methylamino)phenyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.87g/cm3 |
|---|---|
| Boiling Point | 549.7ºC at 760 mmHg |
| Molecular Formula | C13H13Br2N3O2S |
| Molecular Weight | 435.13400 |
| Flash Point | 286.3ºC |
| Exact Mass | 432.91000 |
| PSA | 92.60000 |
| LogP | 5.44430 |
| Index of Refraction | 1.713 |
| InChIKey | IQYVFEBTZCDZIY-UHFFFAOYSA-N |
| SMILES | CNc1c(Br)cc(NS(=O)(=O)c2ccc(N)cc2)cc1Br |
|
~%
4-amino-N-(3,5-... CAS#:7512-70-1 |
| Literature: Senear et al. Journal of Organic Chemistry, 1946 , vol. 11, p. 378,381 |
|
~%
4-amino-N-(3,5-... CAS#:7512-70-1 |
| Literature: Senear et al. Journal of Organic Chemistry, 1946 , vol. 11, p. 378,381 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| sulfanilic acid-(3,5-dibromo-4-methylamino-anilide) |
| Sulfanilsaeure-(3,5-dibrom-4-methylamino-anilid) |
| 2.6-Dibrom-N4-sulfanilyl-N1-methyl-p-phenylendiamin |