3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one,piperazine structure
|
Common Name | 3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one,piperazine | ||
|---|---|---|---|---|
| CAS Number | 75129-78-1 | Molecular Weight | 654.80200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H34N6O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one,piperazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H34N6O4S2 |
|---|---|
| Molecular Weight | 654.80200 |
| Exact Mass | 654.20800 |
| PSA | 189.90000 |
| LogP | 5.20280 |
| InChIKey | YFAZNUDCILFXNO-UHFFFAOYSA-N |
| SMILES | C1CNCCN1.COc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1.COc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1 |
| 2,3-Dihydro-3-(4-methoxyphenyl)-2-thioxo-4(1H)-quinazolinone compd. with piperazine (2:1) |
| 4(1H)-Quinazolinone,2,3-dihydro-3-(4-methoxyphenyl)-2-thioxo-,compd. with piperazine (2:1) |