Fmoc-L-cysteic acid structure
|
Common Name | Fmoc-L-cysteic acid | ||
|---|---|---|---|---|
| CAS Number | 751470-47-0 | Molecular Weight | 391.395 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H17NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.395 |
| Exact Mass | 391.072571 |
| PSA | 138.38000 |
| LogP | 2.06 |
| Index of Refraction | 1.645 |
| InChIKey | BUTKUPGRCQCTTA-INIZCTEOSA-N |
| SMILES | O=C(NC(CS(=O)(=O)O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-sulfo-L-alanine |
| (2R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-sulfopropanoic acid |
| L-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-sulfo- |