Boc-protected Kanamycin A d8-Major
Modify Date: 2025-08-26 22:42:33
Boc-protected Kanamycin A d8-Major structure
|
Common Name | Boc-protected Kanamycin A d8-Major | ||
|---|---|---|---|---|
| CAS Number | 75178-77-7 | Molecular Weight | 684.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H52N4O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Boc-protected Kanamycin A d8-Major |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H52N4O15 |
|---|---|
| Molecular Weight | 684.7 |
| InChIKey | UINNIZSDURJEBV-OSMKSXLKSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1OC(OC2C(NC(=O)OC(C)(C)C)CC(N)C(OC3OC(CO)C(O)C(N)C3O)C2O)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Boc-protected Kanamycin A d8-Major? |
| A: CAS number of Boc-protected Kanamycin A d8-Major is 75178-77-7. |
| Q: What is the Chinese name of 75178-77-7? |
| A: Chinese name of 75178-77-7 is 75178-77-7. |
| Q: What is the English name of Boc-protected Kanamycin A d8-Major? |
| A: The English name of Boc-protected Kanamycin A d8-Major is Boc-protected Kanamycin A d8-Major. |
| Q: What is the SMILES notation of Boc-protected Kanamycin A d8-Major? |
| A: SMILES notation of Boc-protected Kanamycin A d8-Major is CC(C)(C)OC(=O)NCC1OC(OC2C(NC(=O)OC(C)(C)C)CC(N)C(OC3OC(CO)C(O)C(N)C3O)C2O)C(O)C(O)C1O. |
| Q: What is the InChIKey of Boc-protected Kanamycin A d8-Major? |
| A: InChIKey of Boc-protected Kanamycin A d8-Major is UINNIZSDURJEBV-OSMKSXLKSA-N. |
| Q: What is the molecular weight of Boc-protected Kanamycin A d8-Major? |
| A: Molecular weight of Boc-protected Kanamycin A d8-Major is 684.7. |
| Q: What is the molecular formula of Boc-protected Kanamycin A d8-Major? |
| A: Molecular formula of Boc-protected Kanamycin A d8-Major is C28H52N4O15. |