4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonamide structure
|
Common Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7518-98-1 | Molecular Weight | 316.33200 | |
| Density | 1.507g/cm3 | Boiling Point | 549.2ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286ºC | |
| Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 549.2ºC at 760 mmHg |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.33200 |
| Flash Point | 286ºC |
| Exact Mass | 316.05200 |
| PSA | 105.92000 |
| LogP | 2.84920 |
| Index of Refraction | 1.686 |
| InChIKey | RSINXGPYLWVADR-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
|
~%
4-[(1,3-dioxois... CAS#:7518-98-1 |
| Literature: Kominato Kumamoto Medical Journal, 1954 , vol. 6, p. 139,140 |
|
~%
4-[(1,3-dioxois... CAS#:7518-98-1 |
| Literature: Kominato Kumamoto Medical Journal, 1954 , vol. 6, p. 139,140 |
|
~%
4-[(1,3-dioxois... CAS#:7518-98-1 |
| Literature: Al-Suwaidan, Ibrahim A.; Alanazi, Amer M.; El-Azab, Adel S.; Al-Obaid, Abdulrahman M.; Eltahir, Kamal E.H.; Maarouf, Azza R.; Abu El-Enin, Mohamed A.; Abdel-Aziz, Alaa A.-M. Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 9 p. 2601 - 2605 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-phthalimidomethyl-benzenesulfonamide |
| 4-Phthalimidomethyl-benzolsulfonsaeure-amid |
| 4-phthalimidomethyl-benzenesulfonic acid amide |
| N-(4-Sulfamoylbenzyl)-phthalimid |