Anhydrolutein III
Modify Date: 2025-09-24 17:47:14
Anhydrolutein III structure
|
Common Name | Anhydrolutein III | ||
|---|---|---|---|---|
| CAS Number | 752-29-4 | Molecular Weight | 550.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H54O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Anhydrolutein III |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C40H54O |
|---|---|
| Molecular Weight | 550.9 |
| InChIKey | BMQNSHDVIYZULR-FKKUPVFPSA-N |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)C=CCC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CC(O)CC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Anhydrolutein III? |
| A: SMILES notation of Anhydrolutein III is CC(C=CC=C(C)C=CC1=C(C)C=CCC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CC(O)CC1(C)C. |
| Q: What is the InChIKey of Anhydrolutein III? |
| A: InChIKey of Anhydrolutein III is BMQNSHDVIYZULR-FKKUPVFPSA-N. |
| Q: What is the CAS number of Anhydrolutein III? |
| A: CAS number of Anhydrolutein III is 752-29-4. |
| Q: What is the English name of Anhydrolutein III? |
| A: The English name of Anhydrolutein III is Anhydrolutein III. |
| Q: What is the molecular formula of Anhydrolutein III? |
| A: Molecular formula of Anhydrolutein III is C40H54O. |
| Q: What is the molecular weight of Anhydrolutein III? |
| A: Molecular weight of Anhydrolutein III is 550.9. |
| Q: What is the Chinese name of 752-29-4? |
| A: Chinese name of 752-29-4 is 752-29-4. |