1,3,5-Tris(tributylstannyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione
1,3,5-Tris(tributylstannyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione structure
|
Common Name | 1,3,5-Tris(tributylstannyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione | ||
|---|---|---|---|---|
| CAS Number | 752-58-9 | Molecular Weight | 996.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H81N3O3Sn3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C39H81N3O3Sn3 |
|---|---|
| Molecular Weight | 996.18200 |
| Exact Mass | 999.33400 |
| PSA | 107.85000 |
| LogP | 13.74600 |
| InChIKey | ZYSMIQUZIKICMV-UHFFFAOYSA-K |
| SMILES | CCCC[Sn](CCCC)(CCCC)n1c(=O)n([Sn](CCCC)(CCCC)CCCC)c(=O)n([Sn](CCCC)(CCCC)CCCC)c1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:4342-36-3
CAS#:3587-18-6
CAS#:59431-29-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: Molecular formula of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is C39H81N3O3Sn3. |
| Q: What is the InChIKey of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: InChIKey of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is ZYSMIQUZIKICMV-UHFFFAOYSA-K. |
| Q: What is the English name of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: The English name of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane). |
| Q: What is the Chinese name of 752-58-9? |
| A: Chinese name of 752-58-9 is 752-58-9. |
| Q: What is the polar surface area (PSA) of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: Polar surface area (PSA) of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is 107.85000. |
| Q: What are the downstream products of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: Related downstream products(CAS) of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane): 4342-36-3;3587-18-6;59431-29-7. |
| Q: What is the LogP of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: LogP of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is 13.74600. |
| Q: What is the CAS number of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: CAS number of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is 752-58-9. |
| Q: What is the molecular weight of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: Molecular weight of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is 996.18200. |
| Q: What is the SMILES notation of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane)? |
| A: SMILES notation of (2,4,6-Trioxo-S-triazinetriyl)tris(tributylstannane) is CCCC[Sn](CCCC)(CCCC)n1c(=O)n([Sn](CCCC)(CCCC)CCCC)c(=O)n([Sn](CCCC)(CCCC)CCCC)c1=O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |