Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate structure
|
Common Name | Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 752244-05-6 | Molecular Weight | 272.32200 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.32200 |
| Exact Mass | 272.06200 |
| PSA | 71.84000 |
| LogP | 3.23950 |
| Index of Refraction | 1.665 |
| InChIKey | AKUAOHJSADUKFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc2nc(-c3ccccc3)cn12 |
| HS Code | 2934100090 |
|---|
|
~%
Ethyl 6-phenyli... CAS#:752244-05-6 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 43, # 2 p. 393 - 398 |
|
~%
Ethyl 6-phenyli... CAS#:752244-05-6 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 43, # 2 p. 393 - 398 |
|
~%
Ethyl 6-phenyli... CAS#:752244-05-6 |
| Literature: Synthetic Communications, , vol. 37, # 10 p. 1715 - 1722 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |