4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxyethyl]benzene-1,2-diol structure
|
Common Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxyethyl]benzene-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 75241-20-2 | Molecular Weight | 333.37900 | |
| Density | 1.244g/cm3 | Boiling Point | 568.9ºC at 760 mmHg | |
| Molecular Formula | C18H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.8ºC | |
| Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxyethyl]benzene-1,2-diol |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 568.9ºC at 760 mmHg |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.37900 |
| Flash Point | 297.8ºC |
| Exact Mass | 333.15800 |
| PSA | 91.18000 |
| LogP | 2.19910 |
| Index of Refraction | 1.601 |
| InChIKey | DIPGFXJERHNAQQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNCC(O)c2ccc(O)c(O)c2)cc1OC |
| HS Code | 2922509090 |
|---|
|
~%
4-[2-[2-(3,4-di... CAS#:75241-20-2 |
| Literature: Tanabe Seiyaku Co., Ltd. Patent: US3952021 A1, 1976 ; US 3952021 A |
|
~%
4-[2-[2-(3,4-di... CAS#:75241-20-2 |
| Literature: Suzuki; Hashimura; Takeyama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3859 - 3867 |
|
~%
4-[2-[2-(3,4-di... CAS#:75241-20-2 |
| Literature: Suzuki; Hashimura; Takeyama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3859 - 3867 |
|
~%
4-[2-[2-(3,4-di... CAS#:75241-20-2 |
| Literature: Suzuki; Hashimura; Takeyama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3859 - 3867 |
|
~%
4-[2-[2-(3,4-di... CAS#:75241-20-2
Detail
|
| Literature: Suzuki; Hashimura; Takeyama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3859 - 3867 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |