2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile
![2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile Structure](https://image.chemsrc.com/caspic/077/753003-12-2.png)
2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile structure
|
Common Name | 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 753003-12-2 | Molecular Weight | 262.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile (CAS: 753003-12-2, molecular formula: C15H10N4O, molecular weight: 262.266), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10N4O |
|---|---|
| Molecular Weight | 262.26600 |
| Exact Mass | 262.08500 |
| PSA | 74.63000 |
| LogP | 1.66466 |
| InChIKey | KMXZEBOBOJZNRK-UHFFFAOYSA-N |
| SMILES | C#Cc1nc(C#N)c(C#N)n1Cc1ccc(OC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
2-ethynyl-1-[(4... CAS#:753003-12-2 |
| Literature: Densmore, Crystal G.; Rasmussen, Paul G. Macromolecules, 2004 , vol. 37, # 16 p. 5900 - 5910 |
|
~%
2-ethynyl-1-[(4... CAS#:753003-12-2 |
| Literature: Densmore, Crystal G.; Rasmussen, Paul G. Macromolecules, 2004 , vol. 37, # 16 p. 5900 - 5910 |
|
~%
2-ethynyl-1-[(4... CAS#:753003-12-2 |
| Literature: Densmore, Crystal G.; Rasmussen, Paul G. Macromolecules, 2004 , vol. 37, # 16 p. 5900 - 5910 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: SMILES notation of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is C#Cc1nc(C#N)c(C#N)n1Cc1ccc(OC)cc1. |
| Q: What is the polar surface area (PSA) of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: Polar surface area (PSA) of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is 74.63000. |
| Q: What is the English name of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: The English name of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile. |
| Q: What is the LogP of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: LogP of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is 1.66466. |
| Q: What is the Chinese name of 753003-12-2? |
| A: Chinese name of 753003-12-2 is 753003-12-2. |
| Q: What is the InChIKey of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: InChIKey of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is KMXZEBOBOJZNRK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: Molecular weight of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is 262.26600. |
| Q: What is the CAS number of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: CAS number of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is 753003-12-2. |
| Q: What is the molecular formula of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: Molecular formula of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile is C15H10N4O. |
| Q: What are the upstream materials of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile? |
| A: Related upstream materials(CAS) of 2-ethynyl-1-[(4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile: 753003-14-4;824-94-2;50847-09-1. |