9,10-Anthracenedione,1,8-bis[(2-hydroxyethyl)amino]- structure
|
Common Name | 9,10-Anthracenedione,1,8-bis[(2-hydroxyethyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 75312-66-2 | Molecular Weight | 326.34700 | |
| Density | 1.444g/cm3 | Boiling Point | 655.8ºC at 760 mmHg | |
| Molecular Formula | C18H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.4ºC | |
| Name | 1,8-bis(2-hydroxyethylamino)anthracene-9,10-dione |
|---|
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 655.8ºC at 760 mmHg |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.34700 |
| Flash Point | 350.4ºC |
| Exact Mass | 326.12700 |
| PSA | 98.66000 |
| LogP | 1.41640 |
| Index of Refraction | 1.73 |
| InChIKey | NERFPNHSRWWSBD-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(NCCO)c2C(=O)c2c(NCCO)cccc21 |
|
~78%
9,10-Anthracene... CAS#:75312-66-2 |
| Literature: Huang, Hsu-Shan; Chiu, Hui-Fen; Lu, Wei-Chih; Yuan, Chun-Lung Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 9 p. 1136 - 1139 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |