Phenol,4-[1-(6-methoxy-1,3-benzodioxol-5-yl)ethyl]- structure
|
Common Name | Phenol,4-[1-(6-methoxy-1,3-benzodioxol-5-yl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 75393-99-6 | Molecular Weight | 272.29600 | |
| Density | 1.239g/cm3 | Boiling Point | 419.3ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.4ºC | |
| Name | 4-[1-(6-methoxy-1,3-benzodioxol-5-yl)ethyl]phenol |
|---|
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 419.3ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 207.4ºC |
| Exact Mass | 272.10500 |
| PSA | 47.92000 |
| LogP | 3.28130 |
| Index of Refraction | 1.597 |
| InChIKey | RQXBDYWNCHMOQC-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1C(C)c1ccc(O)cc1)OCO2 |
|
~%
Phenol,4-[1-(6-... CAS#:75393-99-6 |
| Literature: Jurd; Narayanan; Paull Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1752 - 1756 |
|
~%
Phenol,4-[1-(6-... CAS#:75393-99-6 |
| Literature: Jurd; Narayanan; Paull Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1752 - 1756 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |