2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride
2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride structure
|
Common Name | 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 754-49-4 | Molecular Weight | 266.03700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5F10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,3,3,4,4,4-Hexafluoro-2-(trifluoromethyl)butanoyl fluoride, Chinese name not provided, CAS number 754-49-4, molecular formula C5F10O, molecular weight 266.03700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5F10O |
|---|---|
| Molecular Weight | 266.03700 |
| Exact Mass | 265.97900 |
| PSA | 17.07000 |
| LogP | 2.95070 |
| InChIKey | BVKQEYOWETVJQK-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3,3,4,4,4-hex... CAS#:754-49-4 |
| Literature: Fawcett,F.S. et al. Journal of the American Chemical Society, 1962 , vol. 84, p. 4275 - 4285 |
|
~%
2,3,3,4,4,4-hex... CAS#:754-49-4 |
| Literature: Abe,T. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1888 - 1892 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Nonafluor-<methylaethylacetyl>-fluorid |
| 2-Trifluormethyl-2,3,3,4,4,4-hexafluor-butyrylfluorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: Molecular weight of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is 266.03700. |
| Q: What is the LogP of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: LogP of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is 2.95070. |
| Q: What is the Chinese name of 754-49-4? |
| A: Chinese name of 754-49-4 is 754-49-4. |
| Q: What is the polar surface area (PSA) of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: Polar surface area (PSA) of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is 17.07000. |
| Q: What is the CAS number of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: CAS number of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is 754-49-4. |
| Q: What is the InChIKey of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: InChIKey of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is BVKQEYOWETVJQK-UHFFFAOYSA-N. |
| Q: What is the English name of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: The English name of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride. |
| Q: What is the molecular formula of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: Molecular formula of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is C5F10O. |
| Q: What is the SMILES notation of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride? |
| A: SMILES notation of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride is O=C(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F. |
| Q: What English synonyms does 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride have? |
| A: English synonyms of 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride: Nonafluor--fluorid, 2-Trifluormethyl-2,3,3,4,4,4-hexafluor-butyrylfluorid. |