2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride structure
|
Common Name | 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 754-49-4 | Molecular Weight | 266.03700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5F10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5F10O |
|---|---|
| Molecular Weight | 266.03700 |
| Exact Mass | 265.97900 |
| PSA | 17.07000 |
| LogP | 2.95070 |
| InChIKey | BVKQEYOWETVJQK-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
|
~%
2,3,3,4,4,4-hex... CAS#:754-49-4 |
| Literature: Fawcett,F.S. et al. Journal of the American Chemical Society, 1962 , vol. 84, p. 4275 - 4285 |
|
~%
2,3,3,4,4,4-hex... CAS#:754-49-4 |
| Literature: Abe,T. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1888 - 1892 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Nonafluor-<methylaethylacetyl>-fluorid |
| 2-Trifluormethyl-2,3,3,4,4,4-hexafluor-butyrylfluorid |