6-butoxy-3,4-dihydro-1H-quinolin-2-one
6-butoxy-3,4-dihydro-1H-quinolin-2-one structure
|
Common Name | 6-butoxy-3,4-dihydro-1H-quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 754232-89-8 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-butoxy-3,4-dihydro-1H-quinolin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 38.33000 |
| LogP | 2.88820 |
| InChIKey | KNYCVXCCPQABPQ-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc2c(c1)CCC(=O)N2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
6-butoxy-3,4-di... CAS#:754232-89-8 |
| Literature: Aki, Shinji; Nishi, Takao; Minamikawa, Jun-Ichi Chemistry Letters, 2004 , vol. 33, # 7 p. 940 - 941 |
|
~%
6-butoxy-3,4-di... CAS#:754232-89-8 |
| Literature: Jin, Hong-Guang; Sun, Xian-Yu; Chai, Kyu-Yun; Piao, Hu-Ri; Quan, Zhe-Shan Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 20 p. 6868 - 6873 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: CAS number of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is 754232-89-8. |
| Q: What is the Chinese name of 754232-89-8? |
| A: Chinese name of 754232-89-8 is 754232-89-8. |
| Q: What is the LogP of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: LogP of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is 2.88820. |
| Q: What is the polar surface area (PSA) of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: Polar surface area (PSA) of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is 38.33000. |
| Q: What is the InChIKey of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: InChIKey of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is KNYCVXCCPQABPQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: SMILES notation of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is CCCCOc1ccc2c(c1)CCC(=O)N2. |
| Q: What is the English name of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: The English name of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is 6-butoxy-3,4-dihydro-1H-quinolin-2-one. |
| Q: What is the molecular weight of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: Molecular weight of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is 219.28000. |
| Q: What are the upstream materials of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: Related upstream materials(CAS) of 6-butoxy-3,4-dihydro-1H-quinolin-2-one: 54197-66-9;109-69-3. |
| Q: What is the molecular formula of 6-butoxy-3,4-dihydro-1H-quinolin-2-one? |
| A: Molecular formula of 6-butoxy-3,4-dihydro-1H-quinolin-2-one is C13H17NO2. |