3-[4-(3-methylphenyl)piperazin-1-yl]propanenitrile structure
|
Common Name | 3-[4-(3-methylphenyl)piperazin-1-yl]propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 75426-48-1 | Molecular Weight | 229.32100 | |
| Density | 1.059g/cm3 | Boiling Point | 413.6ºC at 760 mmHg | |
| Molecular Formula | C14H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.3ºC | |
| Name | 3-[4-(3-methylphenyl)piperazin-1-yl]propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.059g/cm3 |
|---|---|
| Boiling Point | 413.6ºC at 760 mmHg |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.32100 |
| Flash Point | 183.3ºC |
| Exact Mass | 229.15800 |
| PSA | 30.27000 |
| LogP | 2.03358 |
| Index of Refraction | 1.547 |
| InChIKey | RGNKZQPLZJEZLP-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N2CCN(CCC#N)CC2)c1 |
|
~%
3-[4-(3-methylp... CAS#:75426-48-1 |
| Literature: Pollard et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2989 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-(4-m-tolyl-piperazino)-propionitrile |