2,5,8,11,14,17,20-Heptaoxadocosan-22-oic acid structure
|
Common Name | 2,5,8,11,14,17,20-Heptaoxadocosan-22-oic acid | ||
|---|---|---|---|---|
| CAS Number | 75427-75-7 | Molecular Weight | 354.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2,5,8,11,14,17,20-Heptaoxadocosan-22-oic acidm-PEG6-O-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | m-PEG6-O-CH2COOH |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG6-O-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H30O9 |
|---|---|
| Molecular Weight | 354.39 |
| InChIKey | AWSXISOALMMMQQ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCC(=O)O |
| MFCD30536159 |