farnesoic acid structure
|
Common Name | farnesoic acid | ||
|---|---|---|---|---|
| CAS Number | 7548-13-2 | Molecular Weight | 234.33400 | |
| Density | 0.941g/cm3 | Boiling Point | 373.6ºC at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.4ºC | |
| Name | farnesoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.941g/cm3 |
|---|---|
| Boiling Point | 373.6ºC at 760 mmHg |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33400 |
| Flash Point | 273.4ºC |
| Exact Mass | 234.16200 |
| PSA | 37.30000 |
| LogP | 4.26620 |
| Index of Refraction | 1.491 |
| InChIKey | WJHFZYAELPOJIV-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)O |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3,7,11-Trimethyl-2,6,10-dodecatrienoic acid |
| Farnesensaeure |
| Farnesenic acid |
| 3,7,11-trimethyl-dodeca-2,6,10-trienoic acid |
| Farnesolic acid |
| farnesencic acid |
| Farnesylsaeure |
| 3,7,11-Trimethyl-dodeca-2,6,10-triensaeure |
| Farnesic acid |