N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine
![N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine Structure](https://image.chemsrc.com/caspic/349/7549-83-9.png)
N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine structure
|
Common Name | N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 7549-83-9 | Molecular Weight | 201.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H18F2N3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine (Chinese name: 二甲氨基二氟膦基甲基-N-甲基胺), CAS number 7549-83-9, molecular formula C6H18F2N3P, molecular weight 201.19800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H18F2N3P |
|---|---|
| Molecular Weight | 201.19800 |
| Exact Mass | 201.12100 |
| PSA | 23.31000 |
| LogP | 1.73850 |
| InChIKey | ZCPYWQFSAALXCQ-UHFFFAOYSA-N |
| SMILES | CN(C)P(F)(F)(N(C)C)N(C)C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-[bis(dimethylamino)-difluoro |
| Tris(dimethylamino)-difluorophosphorane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: Polar surface area (PSA) of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is 23.31000. |
| Q: What is the SMILES notation of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: SMILES notation of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is CN(C)P(F)(F)(N(C)C)N(C)C. |
| Q: What is the CAS number of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: CAS number of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is 7549-83-9. |
| Q: What is the LogP of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: LogP of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is 1.73850. |
| Q: What English synonyms does N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine have? |
| A: English synonyms of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine: N-[bis(dimethylamino)-difluoro, Tris(dimethylamino)-difluorophosphorane. |
| Q: What is the molecular weight of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: Molecular weight of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is 201.19800. |
| Q: What is the InChIKey of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: InChIKey of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is ZCPYWQFSAALXCQ-UHFFFAOYSA-N. |
| Q: What is the English name of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: The English name of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine. |
| Q: What is the Chinese name of 7549-83-9? |
| A: Chinese name of 7549-83-9 is 7549-83-9. |
| Q: What is the molecular formula of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine? |
| A: Molecular formula of N-[bis(dimethylamino)-difluoro-λ5-phosphanyl]-N-methylmethanamine is C6H18F2N3P. |