3,3,6,6-Tetramethylbicyclo[2.2.1]heptane-2-one-5-thione structure
|
Common Name | 3,3,6,6-Tetramethylbicyclo[2.2.1]heptane-2-one-5-thione | ||
|---|---|---|---|---|
| CAS Number | 75503-13-8 | Molecular Weight | 196.30900 | |
| Density | 1.1g/cm3 | Boiling Point | 272.1ºC at 760 mmHg | |
| Molecular Formula | C11H16OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.4ºC | |
| Name | 2,2,5,5-tetramethyl-3-sulfanylidenebicyclo[2.2.1]heptan-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 272.1ºC at 760 mmHg |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.30900 |
| Flash Point | 118.4ºC |
| Exact Mass | 196.09200 |
| PSA | 49.16000 |
| LogP | 2.62750 |
| Index of Refraction | 1.545 |
| InChIKey | CZRRUXOKFFFXRM-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=O)C2CC1C(=S)C2(C)C |
|
~%
3,3,6,6-Tetrame... CAS#:75503-13-8 |
| Literature: Frost, David C.; Westwood, Nicholas P. C.; Werstiuk, Nick H. Canadian Journal of Chemistry, 1980 , vol. 58, p. 1659 - 1665 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3,6,6-tetramethyl-5-oxo-2-norbornanethione |
| 3,3,6,6-Tetramethyl-5-oxo-bicyclo<2.2.1>heptane-2-thione |