(7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one structure
|
Common Name | (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one | ||
|---|---|---|---|---|
| CAS Number | 755039-55-5 | Molecular Weight | 294.780 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 537.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H19ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.9±28.7 °C | |
| Name | (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-7H-pteridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.5±45.0 °C at 760 mmHg |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.780 |
| Flash Point | 278.9±28.7 °C |
| Exact Mass | 294.124725 |
| PSA | 49.33000 |
| LogP | 1.44 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | RDOMCFLYXZACAX-SNVBAGLBSA-N |
| SMILES | CCC1C(=O)N(C)c2cnc(Cl)nc2N1C1CCCC1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6(5H)-Pteridinone, 2-chloro-8-cyclopentyl-7-ethyl-7,8-dihydro-5-methyl-, (7R)- |
| (7R)-2-Chloro-8-cyclopentyl-7-ethyl-5-methyl-7,8-dihydro-6(5H)-pteridinone |
| (7R)-2-Chloro-8-cyclopentyl-7-ethyl-5-methyl-7,8-dihydropteridin-6(5H)-one |