6,8-dimethoxyflavone structure
|
Common Name | 6,8-dimethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 75523-08-9 | Molecular Weight | 282.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-dimethoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14O4 |
|---|---|
| Molecular Weight | 282.29100 |
| Exact Mass | 282.08900 |
| PSA | 48.67000 |
| LogP | 3.47720 |
| InChIKey | ZDKKBYGKYAQKAS-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2oc(-c3ccccc3)cc(=O)c2c1 |
|
~%
6,8-dimethoxyflavone CAS#:75523-08-9 |
| Literature: Simpson Chemistry and Industry (London, United Kingdom), 1955 , p. 1672 Journal of Organic Chemistry, 1963 , vol. 28, p. 2107 |
|
~%
6,8-dimethoxyflavone CAS#:75523-08-9 |
| Literature: Gowan et al. Tetrahedron, 1958 , vol. 2, p. 116,119 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,8-Dmf |
| 4H-1-Benzopyran-4-one,6,8-dimethoxy-2-phenyl |
| 6,8-dimethoxy-2-phenyl-chromen-4-one |
| 6.8-Dimethoxy-flavon |
| 6,8-Dimethoxyflavone |
| 6,8-Dimethoxy-2-phenyl-chromen-4-on |