[[(2R)-2-[(1R)-1-(4-amino-2-oxopyrimidin-1-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate structure
|
Common Name | [[(2R)-2-[(1R)-1-(4-amino-2-oxopyrimidin-1-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 75567-73-6 | Molecular Weight | 547.08600 | |
| Density | 2.17g/cm3 | Boiling Point | 752.9ºC at 760 mmHg | |
| Molecular Formula | C9H11N3Na3O14P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.1ºC | |
| Name | [[(2R)-2-[(1R)-1-(4-amino-2-oxopyrimidin-1-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.17g/cm3 |
|---|---|
| Boiling Point | 752.9ºC at 760 mmHg |
| Molecular Formula | C9H11N3Na3O14P3 |
| Molecular Weight | 547.08600 |
| Flash Point | 409.1ºC |
| Exact Mass | 546.91500 |
| PSA | 302.02000 |
| LogP | 0.34620 |
| Index of Refraction | 1.694 |
| InChIKey | PAUXEDHSTJAGST-POYBYMJQSA-N |
| SMILES | Nc1ccn(C(C=O)OC(C=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)c(=O)n1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| Cytidine 5'-triphosphate-2',3'-dialdehyde |
| Cytidine 5'-triphosphate,per-iodate oxidized sodium salt |
| Cytidine 5 inverted exclamation marka-triphosphate,per-iodate oxidized sodium salt |
| Cytidine 5 inverted exclamation marka-triphosphate-2 inverted exclamation marka,3 inverted exclamation marka-dialdehyde |