N,N-Dipropyltryptaminehydrochloride
N,N-Dipropyltryptaminehydrochloride structure
|
Common Name | N,N-Dipropyltryptaminehydrochloride | ||
|---|---|---|---|---|
| CAS Number | 7558-73-8 | Molecular Weight | 280.83600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-Dipropyltryptaminehydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H25ClN2 |
|---|---|
| Molecular Weight | 280.83600 |
| Exact Mass | 280.17100 |
| PSA | 19.03000 |
| LogP | 4.63440 |
| InChIKey | AIAASKTUEVUIQM-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCc1c[nH]c2ccccc12.Cl |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N-DipropyltryptamineHCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N,N-Dipropyltryptaminehydrochloride? |
| A: CAS number of N,N-Dipropyltryptaminehydrochloride is 7558-73-8. |
| Q: What is the English name of N,N-Dipropyltryptaminehydrochloride? |
| A: The English name of N,N-Dipropyltryptaminehydrochloride is N,N-Dipropyltryptaminehydrochloride. |
| Q: What is the molecular weight of N,N-Dipropyltryptaminehydrochloride? |
| A: Molecular weight of N,N-Dipropyltryptaminehydrochloride is 280.83600. |
| Q: What is the molecular formula of N,N-Dipropyltryptaminehydrochloride? |
| A: Molecular formula of N,N-Dipropyltryptaminehydrochloride is C16H25ClN2. |
| Q: What English synonyms does N,N-Dipropyltryptaminehydrochloride have? |
| A: English synonyms of N,N-Dipropyltryptaminehydrochloride: N,N-DipropyltryptamineHCl. |
| Q: What is the InChIKey of N,N-Dipropyltryptaminehydrochloride? |
| A: InChIKey of N,N-Dipropyltryptaminehydrochloride is AIAASKTUEVUIQM-UHFFFAOYSA-N. |
| Q: What is the LogP of N,N-Dipropyltryptaminehydrochloride? |
| A: LogP of N,N-Dipropyltryptaminehydrochloride is 4.63440. |
| Q: What is the polar surface area (PSA) of N,N-Dipropyltryptaminehydrochloride? |
| A: Polar surface area (PSA) of N,N-Dipropyltryptaminehydrochloride is 19.03000. |
| Q: What is the SMILES notation of N,N-Dipropyltryptaminehydrochloride? |
| A: SMILES notation of N,N-Dipropyltryptaminehydrochloride is CCCN(CCC)CCc1c[nH]c2ccccc12.Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |