6-(2,2-dimethylpropyl)-2-oxo-1H-pyridine-3-carboxylic acid structure
|
Common Name | 6-(2,2-dimethylpropyl)-2-oxo-1H-pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 75587-96-1 | Molecular Weight | 209.24200 | |
| Density | 1.156g/cm3 | Boiling Point | 407ºC at 760 mmHg | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | 6-(2,2-dimethylpropyl)-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 407ºC at 760 mmHg |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24200 |
| Flash Point | 200ºC |
| Exact Mass | 209.10500 |
| PSA | 70.42000 |
| LogP | 2.07400 |
| Index of Refraction | 1.52 |
| InChIKey | FRHCVEBCJCHBAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1ccc(C(=O)O)c(=O)[nH]1 |
|
~0%
6-(2,2-dimethyl... CAS#:75587-96-1 |
| Literature: Youngdale; Oglia Journal of Medicinal Chemistry, 1985 , vol. 28, # 12 p. 1790 - 1796 |
| 1,2-dihydro-2-oxo-6-neopentylnicotinic acid |
| Dhnpona |
| 1,2-Dihydro-6-neopentyl-2-oxonicotinic acid |