2-methyl-2-(4-nitrophenyl)oxirane structure
|
Common Name | 2-methyl-2-(4-nitrophenyl)oxirane | ||
|---|---|---|---|---|
| CAS Number | 75590-19-1 | Molecular Weight | 179.17300 | |
| Density | 1.291g/cm3 | Boiling Point | 292.1ºC at 760 mmHg | |
| Molecular Formula | C9H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | 2-methyl-2-(4-nitrophenyl)oxirane |
|---|
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 292.1ºC at 760 mmHg |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17300 |
| Flash Point | 140.8ºC |
| Exact Mass | 179.05800 |
| PSA | 58.35000 |
| LogP | 2.36340 |
| Index of Refraction | 1.584 |
| InChIKey | BHJABURPYYGBAY-UHFFFAOYSA-N |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)CO1 |
|
~90%
2-methyl-2-(4-n... CAS#:75590-19-1 |
| Literature: Kavanagh, Sarah A.; Piccinini, Alessandro; Connon, Stephen J. Advanced Synthesis and Catalysis, 2010 , vol. 352, # 11-12 p. 2089 - 2093 |
|
~35%
2-methyl-2-(4-n... CAS#:75590-19-1 |
| Literature: Cleij; Archelas; Furstoss Journal of Organic Chemistry, 1999 , vol. 64, # 14 p. 5029 - 5035 |