1,2,2,4,6,6-hexamethylpiperidin-4-ol structure
|
Common Name | 1,2,2,4,6,6-hexamethylpiperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 75620-69-8 | Molecular Weight | 185.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,2,4,6,6-hexamethylpiperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H23NO |
|---|---|
| Molecular Weight | 185.30600 |
| Exact Mass | 185.17800 |
| PSA | 23.47000 |
| LogP | 1.95810 |
| InChIKey | KFUQPNOFIUGHLY-UHFFFAOYSA-N |
| SMILES | CN1C(C)(C)CC(C)(O)CC1(C)C |
|
~89%
1,2,2,4,6,6-hex... CAS#:75620-69-8 |
| Literature: Belostotskii, A. M.; Shapiro, A. B. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1991 , vol. 40, # 2.2 p. 421 - 429 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1991 , vol. 40, # 2 p. 486 - 496 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2,2,4,6,6-hexamethyl-4-piperidinol |
| 4-Piperidinol,1,2,2,4,6,6-hexamethyl |
| 1,2,2,4,6,6-hexamethyl-4-piperidol |