4-acetyl-5,6-bis(4-chlorophenyl)-2-(1-hydroxypropan-2-yl)pyridazin-3-one structure
|
Common Name | 4-acetyl-5,6-bis(4-chlorophenyl)-2-(1-hydroxypropan-2-yl)pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 75643-73-1 | Molecular Weight | 417.28500 | |
| Density | 1.34g/cm3 | Boiling Point | 584ºC at 760 mmHg | |
| Molecular Formula | C21H18Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307ºC | |
| Name | 4-acetyl-5,6-bis(4-chlorophenyl)-2-(1-hydroxypropan-2-yl)pyridazin-3-one |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 584ºC at 760 mmHg |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.28500 |
| Flash Point | 307ºC |
| Exact Mass | 416.06900 |
| PSA | 72.19000 |
| LogP | 4.64000 |
| Index of Refraction | 1.63 |
| InChIKey | VCXLMEHFCKQBTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nn(C(C)CO)c1=O |
|
~52%
4-acetyl-5,6-bi... CAS#:75643-73-1 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |