5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)-3-oxo-pyridazine-4-carboxylic acid structure
|
Common Name | 5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)-3-oxo-pyridazine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 75643-75-3 | Molecular Weight | 405.23100 | |
| Density | 1.46g/cm3 | Boiling Point | 565.6ºC at 760 mmHg | |
| Molecular Formula | C19H14Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.8ºC | |
| Name | 5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)-3-oxopyridazine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 565.6ºC at 760 mmHg |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.23100 |
| Flash Point | 295.8ºC |
| Exact Mass | 404.03300 |
| PSA | 92.42000 |
| LogP | 3.57460 |
| Index of Refraction | 1.661 |
| InChIKey | XDPYUAIWWWKAKI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nn(CCO)c1=O |
|
~81%
5,6-bis(4-chlor... CAS#:75643-75-3 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
|
~%
5,6-bis(4-chlor... CAS#:75643-75-3 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Antihypertensive activity in spontaneously hypertensive rats, measured as average blo...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL778762
|
| 2-(2-hydroxyethyl)-5,6-bis(4-chlorophenyl)-3-oxo-pyridazin-4-ylcarboxylic acid |