4-Pyridazinecarbonitrile, 5,6-bis(4-chlorophenyl)-2,3-dihydro-2-(2-hydroxyethyl)-3-oxo- structure
|
Common Name | 4-Pyridazinecarbonitrile, 5,6-bis(4-chlorophenyl)-2,3-dihydro-2-(2-hydroxyethyl)-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 75644-05-2 | Molecular Weight | 386.23100 | |
| Density | 1.38g/cm3 | Boiling Point | 543.5ºC at 760 mmHg | |
| Molecular Formula | C19H13Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.5ºC | |
| Name | 5,6-bis(4-chlorophenyl)-2-(2-hydroxyethyl)-3-oxopyridazine-4-carbonitrile |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 543.5ºC at 760 mmHg |
| Molecular Formula | C19H13Cl2N3O2 |
| Molecular Weight | 386.23100 |
| Flash Point | 282.5ºC |
| Exact Mass | 385.03800 |
| PSA | 78.91000 |
| LogP | 3.74808 |
| Index of Refraction | 1.656 |
| InChIKey | XYKMDIKOEHWYBP-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nn(CCO)c1=O |
|
~59%
4-Pyridazinecar... CAS#:75644-05-2 |
| Literature: Buchman; Scozzie; Ariyan; Heilman; Rippin; Pyne; Powers; Matthews Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1398 - 1405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |