Lacto-N-triose II structure
|
Common Name | Lacto-N-triose II | ||
|---|---|---|---|---|
| CAS Number | 75645-27-1 | Molecular Weight | 545.48900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H35NO16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lacto-N-triose IILacto-N-triose II is a core structural unit of human milk oligosaccharides (HMOs). Lacto-N-triose II owns nutraceutical potentials and can be used in the production of complex HMOs[1]. |
| Name | N-[(2S,3R,4R,5S,6R)-5-hydroxy-6-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Lacto-N-triose II is a core structural unit of human milk oligosaccharides (HMOs). Lacto-N-triose II owns nutraceutical potentials and can be used in the production of complex HMOs[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H35NO16 |
|---|---|
| Molecular Weight | 545.48900 |
| Exact Mass | 545.19600 |
| PSA | 281.04000 |
| InChIKey | CJOPBLPCFAQCNO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Lacto-N-triose II |
| Lacto-N-triose I |
| lacto-n-triaose |
| Agalacto-N-neotetraose |