1-(1-hydroxy-6-methyl-9H-carbazol-2-yl)-3-phenylprop-2-en-1-one structure
|
Common Name | 1-(1-hydroxy-6-methyl-9H-carbazol-2-yl)-3-phenylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 756482-79-8 | Molecular Weight | 327.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-hydroxy-6-methyl-9H-carbazol-2-yl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H17NO2 |
|---|---|
| Molecular Weight | 327.37600 |
| Exact Mass | 327.12600 |
| PSA | 53.09000 |
| LogP | 5.23120 |
| InChIKey | JURNZPKLIAZNMM-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c3c(O)c(C(=O)C=Cc4ccccc4)ccc3c2c1 |
|
~48%
1-(1-hydroxy-6-... CAS#:756482-79-8 |
| Literature: Vandana; Rajendra Prasad Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 4 p. 819 - 822 |
|
~44%
1-(1-hydroxy-6-... CAS#:756482-79-8 |
| Literature: Chellappan, Kavitha; Prasad, Karnam Jayarampillai R. Journal of Chemical Research, Miniprint, 2003 , # 10 p. 1025 - 1036 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-cinnamoyl-6-methyl-1-hydroxycarbazole |