9,10-dimethoxy-1,2,3,4,5,6,7,8-octamethylanthracene structure
|
Common Name | 9,10-dimethoxy-1,2,3,4,5,6,7,8-octamethylanthracene | ||
|---|---|---|---|---|
| CAS Number | 75670-41-6 | Molecular Weight | 350.49400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,10-dimethoxy-1,2,3,4,5,6,7,8-octamethylanthracene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H30O2 |
|---|---|
| Molecular Weight | 350.49400 |
| Exact Mass | 350.22500 |
| PSA | 18.46000 |
| LogP | 6.47740 |
| InChIKey | MARSPMUGEUABJO-UHFFFAOYSA-N |
| SMILES | COc1c2c(C)c(C)c(C)c(C)c2c(OC)c2c(C)c(C)c(C)c(C)c12 |
|
~99%
9,10-dimethoxy-... CAS#:75670-41-6 |
| Literature: Hart, Harold; Lai, Chung-yin; Nwokogu, Godson Chukuemaka; Shamouilian, Shamouil Tetrahedron, 1987 , vol. 43, # 22 p. 5203 - 5224 |
|
~%
9,10-dimethoxy-... CAS#:75670-41-6 |
| Literature: Hart, Harold; Lai, Chung-yin; Nwokogu, Godson; Shamouilian, Shamouil; Teuerstein, Avraham; Zlotogorski, Chana Journal of the American Chemical Society, 1980 , vol. 102, # 21 p. 6649 - 6651 |
|
~%
9,10-dimethoxy-... CAS#:75670-41-6 |
| Literature: Hart, Harold; Lai, Chung-yin; Nwokogu, Godson Chukuemaka; Shamouilian, Shamouil Tetrahedron, 1987 , vol. 43, # 22 p. 5203 - 5224 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Anthracene,9,10-dimethoxy-1,2,3,4,5,6,7,8-octamethyl |
| 9,10-dimethoxy-1,2,3,4,5,6,7,8-octamethyl-anthracene |
| BIDD:GT0750 |
| 9,10-dimethoxyoctamethylanthracene |