3,3,5-Trimethylcyclohexyl methacrylate
Modify Date: 2026-06-15 22:47:09
3,3,5-Trimethylcyclohexyl methacrylate structure
|
Common Name | 3,3,5-Trimethylcyclohexyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 75673-26-6 | Molecular Weight | 210.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,5-Trimethylcyclohexyl methacrylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22O2 |
|---|---|
| Molecular Weight | 210.31 |
| InChIKey | DABQKEQFLJIRHU-UHFFFAOYSA-N |
| SMILES | CC1CC(CC(C1)(C)C)OC(=O)C(=C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 186, Current Page 1 of 19
1
2
3
4
5
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3,3,5-Trimethylcyclohexyl methacrylate? |
| A: CAS number of 3,3,5-Trimethylcyclohexyl methacrylate is 75673-26-6. |
| Q: What is the Chinese name of 75673-26-6? |
| A: Chinese name of 75673-26-6 is 75673-26-6. |
| Q: What is the molecular formula of 3,3,5-Trimethylcyclohexyl methacrylate? |
| A: Molecular formula of 3,3,5-Trimethylcyclohexyl methacrylate is C13H22O2. |
| Q: What is the InChIKey of 3,3,5-Trimethylcyclohexyl methacrylate? |
| A: InChIKey of 3,3,5-Trimethylcyclohexyl methacrylate is DABQKEQFLJIRHU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,3,5-Trimethylcyclohexyl methacrylate? |
| A: Molecular weight of 3,3,5-Trimethylcyclohexyl methacrylate is 210.31. |
| Q: What is the English name of 3,3,5-Trimethylcyclohexyl methacrylate? |
| A: The English name of 3,3,5-Trimethylcyclohexyl methacrylate is 3,3,5-Trimethylcyclohexyl methacrylate. |
| Q: What is the SMILES notation of 3,3,5-Trimethylcyclohexyl methacrylate? |
| A: SMILES notation of 3,3,5-Trimethylcyclohexyl methacrylate is CC1CC(CC(C1)(C)C)OC(=O)C(=C)C. |