N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide
Modify Date: 2025-08-20 12:48:09
![N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide Structure](https://www.chemsrc.com/extcaspic/443/756809-67-3.png)
N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide structure
|
Common Name | N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 756809-67-3 | Molecular Weight | 396.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H24N2O4S2 |
|---|---|
| Molecular Weight | 396.5 |
| InChIKey | LLPNSVGNDQVJJM-UHFFFAOYSA-N |
| SMILES | CNCc1cc(S(=O)(=O)N(C)CCO)ccc1Oc1ccc(SC)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Drug metabolism in human assessed as demethylation
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL987978
|
|
Name: Selectivity for human serotonin transporter over human noradrenaline transporter
Source: ChEMBL
Target: N/A
External Id: CHEMBL987977
|
|
Name: Inhibition of [3H]5HT reuptake at human serotonin transporter expressed in HEK293 cel...
Source: ChEMBL
Target: Sodium-dependent serotonin transporter
External Id: CHEMBL987973
|
|
Name: Selectivity for human serotonin transporter over human dopamine transporter
Source: ChEMBL
Target: N/A
External Id: CHEMBL987976
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide? |
| A: InChIKey of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide is LLPNSVGNDQVJJM-UHFFFAOYSA-N. |
| Q: What is the English name of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide? |
| A: The English name of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide is N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide. |
| Q: What is the SMILES notation of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide? |
| A: SMILES notation of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide is CNCc1cc(S(=O)(=O)N(C)CCO)ccc1Oc1ccc(SC)cc1. |
| Q: What is the Chinese name of 756809-67-3? |
| A: Chinese name of 756809-67-3 is 756809-67-3. |
| Q: What is the CAS number of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide? |
| A: CAS number of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide is 756809-67-3. |
| Q: What is the molecular weight of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide? |
| A: Molecular weight of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide is 396.5. |
| Q: What is the molecular formula of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide? |
| A: Molecular formula of N-(2-Hydroxyethyl)-N-methyl-3-[(methylamino)methyl]-4-[4-(methylthio)phenoxy]benzenesulfonamide is C18H24N2O4S2. |