trans-3,4-(Methylenedioxy)cinnamic acid
Modify Date: 2026-06-28 10:00:09
trans-3,4-(Methylenedioxy)cinnamic acid structure
|
Common Name | trans-3,4-(Methylenedioxy)cinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 75684-35-4 | Molecular Weight | 192.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trans-3,4-(Methylenedioxy)cinnamic acid |
|---|
| Molecular Formula | C10H8O4 |
|---|---|
| Molecular Weight | 192.17 |
| InChIKey | QFQYZMGOKIROEC-RQOWECAXSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C\C(=O)O |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
Total 1, Current Page 1 of 1
1