EN106 structure
|
Common Name | EN106 | ||
|---|---|---|---|---|
| CAS Number | 757192-67-9 | Molecular Weight | 280.71 | |
| Density | 1.351±0.06 g/cm3(Predicted) | Boiling Point | 489.1±45.0 °C(Predicted) | |
| Molecular Formula | C13H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EN106EN106 is a potent inhibitor of FEMIB. EN106 is a cysteine-reactive covalent ligand. EN106 disrupts recognition of the key reductive stress substrate of FEM1B, FNIP1[1]. |
| Name | EN106 |
|---|
| Description | EN106 is a potent inhibitor of FEMIB. EN106 is a cysteine-reactive covalent ligand. EN106 disrupts recognition of the key reductive stress substrate of FEM1B, FNIP1[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.351±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 489.1±45.0 °C(Predicted) |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 |
| InChIKey | GLDJSVHDOXCYPT-UHFFFAOYSA-N |
| SMILES | N#CCCN(C(=O)CCl)c1ccc2c(c1)OCCO2 |
| Storage condition | -20°C |