1-Oxa-8-azaspiro[4.5]decane-8-carboxylic acid, 4-hydroxy-, 1,1-dimethylethyl ester structure
|
Common Name | 1-Oxa-8-azaspiro[4.5]decane-8-carboxylic acid, 4-hydroxy-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 757239-67-1 | Molecular Weight | 257.32600 | |
| Density | 1.16g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | 2-Methyl-2-propanyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carbo xylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.32600 |
| Flash Point | 190.3ºC |
| Exact Mass | 257.16300 |
| PSA | 59.00000 |
| LogP | 1.47520 |
| Index of Refraction | 1.52 |
| InChIKey | CQVZWCSKELNHRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OCCC2O |
|
~%
1-Oxa-8-azaspir... CAS#:757239-67-1 |
| Literature: MERCK SHARP and DOHME LIMITED Patent: WO2004/78750 A1, 2004 ; Location in patent: Page 84 ; WO 2004/078750 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| tert-butyl 4-hydroxy-1-methylcyclohexylcarbamate |