5-((4-Nitrophenyl)sulfonyl)-2-furancarbonitrile structure
|
Common Name | 5-((4-Nitrophenyl)sulfonyl)-2-furancarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 75745-64-1 | Molecular Weight | 278.24100 | |
| Density | 1.6g/cm3 | Boiling Point | 511.5ºC at 760 mmHg | |
| Molecular Formula | C11H6N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | 5-(4-nitrophenyl)sulfonylfuran-2-carbonitrile |
|---|
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 511.5ºC at 760 mmHg |
| Molecular Formula | C11H6N2O5S |
| Molecular Weight | 278.24100 |
| Flash Point | 263.1ºC |
| Exact Mass | 278.00000 |
| PSA | 125.27000 |
| LogP | 3.49628 |
| Index of Refraction | 1.649 |
| InChIKey | DLWOIIRIGKRTMK-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)o1 |
|
~53%
5-((4-Nitrophen... CAS#:75745-64-1 |
| Literature: Shridhar, D. R.; Jogibhukta, M.; Reddy, P. Gopal; Krishnan, V. S. H. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 5 p. 386 - 388 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |