H-D-Thr-OBzl.HCl structure
|
Common Name | H-D-Thr-OBzl.HCl | ||
|---|---|---|---|---|
| CAS Number | 75748-36-6 | Molecular Weight | 245.703 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO3 | Melting Point | 128.0 to 132.0 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl (2R,3S)-2-amino-3-hydroxybutanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 128.0 to 132.0 °C |
|---|---|
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.703 |
| Exact Mass | 245.081863 |
| PSA | 72.55000 |
| LogP | 1.94020 |
| InChIKey | IDZGTFSDZJVMSD-KXNXZCPBSA-N |
| SMILES | CC(O)C(N)C(=O)OCc1ccccc1.Cl |
| H-D-Thr-OBzl.HCl |
| D-Allothreonine, phenylmethyl ester, hydrochloride (1:1) |
| Benzyl D-threoninate hydrochloride (1:1) |
| D-Threonine Benzyl Ester Hydrochloride |
| Benzyl D-allothreoninate hydrochloride (1:1) |
| D-Threonine, phenylmethyl ester, hydrochloride (1:1) |
| T2788 |