1,3,5,6-tetramethylspiro[benzimidazole-2,1'-cyclopentane] structure
|
Common Name | 1,3,5,6-tetramethylspiro[benzimidazole-2,1'-cyclopentane] | ||
|---|---|---|---|---|
| CAS Number | 75751-20-1 | Molecular Weight | 230.34900 | |
| Density | 1.08g/cm3 | Boiling Point | 388.9ºC at 760 mmHg | |
| Molecular Formula | C15H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 1,3,5,6-tetramethylspiro[benzimidazole-2,1'-cyclopentane] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 388.9ºC at 760 mmHg |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.34900 |
| Flash Point | 175.3ºC |
| Exact Mass | 230.17800 |
| PSA | 6.48000 |
| LogP | 3.58970 |
| Index of Refraction | 1.594 |
| InChIKey | WWHRITWAHDSGEL-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1C)N(C)C1(CCCC1)N2C |
|
~82%
1,3,5,6-tetrame... CAS#:75751-20-1 |
| Literature: Nelsen, Stephen F.; Grezzo, Loretta A.; Hollinsed, William C. Journal of Organic Chemistry, 1981 , vol. 46, # 2 p. 283 - 289 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,5,6-Tetramethyl-2,2-tetramethylenebenzimidazole |