Piperidine,4-(1,1-dimethylethyl)-1-(phenylmethyl) structure
|
Common Name | Piperidine,4-(1,1-dimethylethyl)-1-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 7576-09-2 | Molecular Weight | 231.37600 | |
| Density | 0.955g/cm3 | Boiling Point | 300.3ºC at 760mmHg | |
| Molecular Formula | C16H25N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.6ºC | |
| Name | 1-benzyl-4-tert-butylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.955g/cm3 |
|---|---|
| Boiling Point | 300.3ºC at 760mmHg |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.37600 |
| Flash Point | 123.6ºC |
| Exact Mass | 231.19900 |
| PSA | 3.24000 |
| LogP | 3.88260 |
| Index of Refraction | 1.523 |
| InChIKey | JCOVUSCGLXPGCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCN(Cc2ccccc2)CC1 |
|
~%
Piperidine,4-(1... CAS#:7576-09-2 |
| Literature: Meyers, A. I.; Shawe, Thomas T.; Gottlieb, Levi Tetrahedron Letters, 1992 , vol. 33, # 7 p. 867 - 870 |
|
~97%
Piperidine,4-(1... CAS#:7576-09-2 |
| Literature: Meyers, A. I.; Shawe, Thomas T.; Gottlieb, Levi Tetrahedron Letters, 1992 , vol. 33, # 7 p. 867 - 870 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-Benzyl-4-tert.-butyl-piperidin |
| 1-benzyl-4-tert-butyl-piperidine |